| Identification | |
| Name: | endo,endo-Dihydrodi(norbornadiene) |
| Synonyms: | RJ-5 |
| CAS: | 66289-74-5 |
| Molecular Formula: | C14H18 |
| Molecular Weight: | 186.296 |
| InChI: | InChI=1S/C14H18/c1-2-6-3-5(1)9-10(6)12-7-4-8-13(11(7)9)14(8)12/h5-14H,1-4H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 95.3°C |
| Boiling Point: | 269.1°Cat760mmHg |
| Density: | 1.213g/cm3 |
| Specification: |
endo,endo-Dihydrodi(norbornadiene) , its cas register number is 66289-74-5. It also can be called 4,7-Methano-2,3,8-methenocyclopent(a)indene, dodecahydro-, stereoisomer ; RJ 5 ; and Shelloyne H . |
| Flash Point: | 95.3°C |
| Safety Data | |
 |
|
