| Identification | |
| Name: | 2-Methoxy-4-methyl-5-nitropyridine |
| Synonyms: | 2-methoxy-4-methyl-5-nitro-pyridine;2-Methoxy-5-nitro-3-methylpyridine;6-methoxy-3-methyl-2-nitropyridine;2-Methoxy-5-nitro-4-methylprydine;2-methoxy-5-nitro-4-icoline;2-methoxyl-5-nitropicoline; |
| CAS: | 6635-90-1 |
| Molecular Formula: | C7H8N2O3 |
| Molecular Weight: | 168.15212 |
| InChI: | InChI=1/C7H8N2O3/c1-5-3-7(12-2)8-4-6(5)9(10)11/h3-4H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.247 g/cm3 |
| Refractive index: | 1.541 |
| Appearance: | Off-white solid |
| Specification: | Off-white solid Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Safety Data | |
 |
|
