| Identification |
| Name: | Methanone,(4-chlorophenyl)cyclopropyl- |
| Synonyms: | Ketone,p-chlorophenyl cyclopropyl (6CI,7CI,8CI);(p-Chlorobenzoyl)cyclopropane;4-Chlorophenyl cyclopropyl ketone;Cyclopropyl 4-chlorophenyl ketone;NSC49315;p-Chlorophenyl cyclopropyl ketone; |
| CAS: | 6640-25-1 |
| EINECS: | 229-655-2 |
| Molecular Formula: | C10H9ClO |
| Molecular Weight: | 180.63 |
| InChI: | InChI=1/C10H9ClO/c11-9-5-3-8(4-6-9)10(12)7-1-2-7/h3-7H,1-2H2 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.16 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5698-1.5718 |
| Appearance: | clear colorless to light amber liquid. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| |
 |
