| Identification | |
| Name: | 2-Propenoic acid,(5-ethyl-1,3-dioxan-5-yl)methyl ester |
| Synonyms: | (5-Ethyl-1,3-dioxan-5-yl)methylacrylate; 5-Acryloxymethyl-5-ethyl-1,3-dioxacyclohexane; 5-Ethyl-5-(hydroxymethyl)-1,3-dioxaneacrylate; Laromer 8887; Laromer LR 8887; SR 531; Sartomer 531; Sartomer SR 531;Trimethylolpropane formal acrylate |
| CAS: | 66492-51-1 |
| EINECS: | 266-380-7 |
| Molecular Formula: | C10H16 O4 |
| Molecular Weight: | 200.23164 |
| InChI: | InChI=1/C9H14O4/c1-3-9(7(2)8(10)11)4-12-6-13-5-9/h2-6H2,1H3,(H,10,11)/p-1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 147°C |
| Boiling Point: | Vapour density: |
| Stability: | Unstable; may be sold with an inhibitor added. Incompatible with strong oxidizing agents. |
| Solubility: |
|
| Appearance: | yellow liquid |
| Flash Point: | 147°C |
| Safety Data | |
 |
|
