| Identification | |
| Name: | (S)-4-Amino-3-(4-chlorophenyl)butanoic acid |
| Synonyms: | Benzenepropanoic acid, beta-(aminomethyl)-4-chloro-, (betaS)-;S(+)-Baclofen;(3S)-4-amino-3-(4-chlorophenyl)butanoic acid;(L)-Baclofen;(+)-Baclofen;L-(+)-Baclofen;(S)-Baclofen; |
| CAS: | 66514-99-6 |
| Molecular Formula: | C10H12ClNO2 |
| Molecular Weight: | 213.66 |
| InChI: | InChI=1/C10H12ClNO2/c11-9-3-1-7(2-4-9)8(6-12)5-10(13)14/h1-4,8H,5-6,12H2,(H,13,14)/t8-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 174.1°C |
| Boiling Point: | 364.3°Cat760mmHg |
| Density: | 1.285g/cm3 |
| Specification: |
The (S)-4-Amino-3-(4-chlorophenyl)butanoic acid with cas registry number of 66514-99-6, its system generated number is 0066514996. Its systematic name is Benzenepropanoic acid, beta-(aminomethyl)-4-chloro-, (betaS)-. And it is also called d-Baclofen. You can still convert the following datas into molecular structure: |
| Flash Point: | 174.1°C |
| Usage: | S-Enantiomer of Baclofen. Specific GABA-B receptor agonist. Muscle relaxant (skeletal). |
| Safety Data | |
 |
|
