| Identification | |
| Name: | 2-Oxiranemethanol,2-nitrate |
| Synonyms: | 1-Propanol,2,3-epoxy-, nitrate (7CI,8CI); Oxiranemethanol, nitrate (9CI);1,2-Epoxy-3-nitratopropane; Glycidyl nitrate; NSC 137875 |
| CAS: | 6659-62-7 |
| EINECS: | 229-698-7 |
| Molecular Formula: | C3H5 N O4 |
| Molecular Weight: | 119.08 |
| InChI: | InChI=1/C3H5NO4/c5-4(6)8-2-3-1-7-3/h3H,1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Flash Point: | 101.5°C |
| Boiling Point: | 179.7°C at 760 mmHg |
| Density: | 1.409g/cm3 |
| Refractive index: | 1.463 |
| Specification: |
2,3-Epoxypropyl nitrate with CAS Registry Number of 6659-62-7 is also known as 5-17-03-00048 (Beilstein Handbook Reference) ; Glycidyl nitrate ; NSC 137875 ; 1-Propanol, 2,3-epoxy-, nitrate ; Oxiranemethanol, nitrate (9CI) . |
| Packinggroup: | III |
| Flash Point: | 101.5°C |
| Safety Data | |
 |
|
