| Identification | |
| Name: | 3-Pyridinamine,6-chloro-4-methyl- |
| Synonyms: | (6-Chloro-4-methylpyridin-3-yl)amine;3-Amino-6-chloro-4-methylpyridine;3-Amino-6-chloro-4-picoline;5-Amino-2-chloro-4-methylpyridine; |
| CAS: | 66909-38-4 |
| Molecular Formula: | C6H7ClN2 |
| Molecular Weight: | 142.58 |
| InChI: | InChI=1/C6H7ClN2/c1-4-2-6(7)9-3-5(4)8/h2-3H,8H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 69-73 °C |
| Flash Point: | 141.1°C |
| Boiling Point: | 309.7°Cat760mmHg |
| Density: | 1.26g/cm3 |
| Refractive index: | 1.592 |
| Appearance: | bordeaux to brownish powder |
| Specification: |
3-Pyridinamine,6-chloro-4-methyl- , its cas register number is 66909-38-4. It also can be called 6-Chloro-4-methylpyridin-3-amine ; 3-Amino-6-Chloro-4-Methylpyridine . 3-Pyridinamine,6-chloro-4-methyl- (CAS NO.66909-38-4) is irritating to eyes, respiratory system and skin and it is also harmful by inhalation, in contact with skin and if swallowed. So you should wear suitable protective clothing, gloves and eye/face protection. |
| Flash Point: | 141.1°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
