| Identification | |
| Name: | 5-Allyl-5-(1-(allythio)ethyl)barbituric acid sodium salt |
| Synonyms: | 5-Allyl-5-[1-(allylthio)ethyl]-2-sodiooxy-4,6(1H,5H)-pyrimidinedione |
| CAS: | 66941-48-8 |
| Molecular Formula: | C12H15N2O3S . Na |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C12H16N2O3S.Na/c1-4-6-12(8(3)18-7-5-2)9(15)13-11(17)14-10(12)16;/h4-5,8H,1-2,6-7H2,3H3,(H2,13,14,15,16,17);/q;+1/p-1 |
| Molecular Structure: | ![(C12H15N2O3S.Na) 5-Allyl-5-[1-(allylthio)ethyl]-2-sodiooxy-4,6(1H,5H)-pyrimidinedione](https://img.guidechem.com/crawlimg/66941-48-8.png) |
| Properties | |
| Specification: |
5-Allyl-5-(1-(allythio)ethyl)barbituric acid sodium salt ,with CAS number of 66941-48-8,can be called Sodium 5-allyl-5-(1-(allylthio)ethyl)barbiturate . 5-Allyl-5-(1-(allythio)ethyl)barbituric acid sodium salt (CAS NO.66941-48-8) is a moderately toxic substance,with flammability, burning will produce toxic nitrogen oxides, sulfur oxides and sodium oxide smoke,so it should be stored in cool and dry environment,seprated from food and material.Dry powder,foam,sand, carbon dioxide,water mist can be used if something urgent happened. |
| Safety Data | |
 |
|
