| Identification | |
| Name: | Methoxy triethylene glycol vinyl ether |
| Synonyms: | 2-[2-(2-Vinyloxyethoxy)ethoxy]acetic acid methyl ester |
| CAS: | 66967-60-0 |
| Molecular Formula: | C9H16O5 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C9H16O5/c1-3-12-4-5-13-6-7-14-8-9(10)11-2/h3H,1,4-8H2,2H3 |
| Molecular Structure: | ![(C9H16O5) 2-[2-(2-Vinyloxyethoxy)ethoxy]acetic acid methyl ester](https://img.guidechem.com/crawlimg/66967-60-0.png) |
| Properties | |
| Flash Point: | 112.1°C |
| Boiling Point: | 267.5°C at 760 mmHg |
| Density: | 1.048g/cm3 |
| Refractive index: | 1.431 |
| Specification: |
Methoxy triethylene glycol vinyl ether , its cas register number is 66967-60-0. It also can be called Acetic acid, 2-(2-(2-vinyloxy)ethoxy)ethoxy-, methyl ester . |
| Report: |
Glycol ethers are on the Community Right-To-Know List. |
| Flash Point: | 112.1°C |
| Safety Data | |
 |
|
