| Identification | |
| Name: | 1H-Imidazole,2,5-diphenyl- |
| Synonyms: | 1H-Imidazole,2,4-diphenyl- (6CI,9CI); Imidazole, 2,4(or 2,5)-diphenyl- (7CI); Imidazole,2,4-diphenyl- (8CI); 2,4-Diphenyl-1H-imidazole; 2,4-Diphenylimidazole;2,5-Diphenylimidazole; NSC 167196 |
| CAS: | 670-83-7 |
| Molecular Formula: | C15H12 N2 |
| Molecular Weight: | 220.2692 |
| InChI: | InChI=1/C15H12N2/c1-3-7-12(8-4-1)14-11-16-15(17-14)13-9-5-2-6-10-13/h1-11H,(H,16,17) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.149 g/cm3 |
| Refractive index: | 1.627 |
| Appearance: | Allmost white crystal |
| Specification: |
1H-Imidazole,2,5-diphenyl- , its cas register number is 670-83-7. It also can be called 1H-imidazole, 2,4-diphenyl- ; and 2,4-Diphenyl-1H-imidazole ; and 2,4-Diphenylimidazole . |
| Safety Data | |
 |
|
