| Identification | |
| Name: | 1H-Imidazole, 5-phenyl- |
| Synonyms: | 1H-Imidazole,4-phenyl- (9CI);Imidazole, 4-phenyl- (6CI,7CI,8CI);4(5)-Phenylimidazole;4-Phenyl-1H-imidazole;4-Phenylimidazole;5-Phenylimidazole;NSC 195337; |
| CAS: | 670-95-1 |
| EINECS: | 211-580-1 |
| Molecular Formula: | C9H8N2 |
| Molecular Weight: | 144.17322 |
| InChI: | InChI=1S/C9H8N2/c1-2-4-8(5-3-1)9-6-10-7-11-9/h1-7H,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | 213 ºC |
| Boiling Point: | 379.8 ºC |
| Density: | 1.141 g/cm3 |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble
Appearance:white powder Transport Information:25kgs Hazard Symbols:UN NO. |
| Appearance: | white powder |
| Specification: |
Wash thoroughly after handling. Remove contaminated clothing and wash before reuse. Avoid contact with eyes, skin, and clothing. Avoid ingestion and inhalation.Store in a cool, dry place. Keep container closed when not in use. |
| Flash Point: | 213 ºC |
| Usage: | An imidazole derivative as antitermite agent. |
| Safety Data | |
| Hazard Symbols | |
 |
|
