| Identification | |
| Name: | Methyl-2-methoxy-5-N-dimethyltryptamine |
| Synonyms: | 4365 CT;BRN 0179917;Methyl-2-methoxy-5-N-dimethyltryptamine;2-(5-methoxy-2-methyl-1H-indol-3-yl)-N,N-dimethylethanamine;INDOLE, 3-(2-(DIMETHYLAMINO)ETHYL)-5-METHOXY-2-METHYL-;67292-68-6;AC1L2MB5;AC1Q56LA;CHEMBL7143;CHEBI:101925;PDSP1_001416;PDSP2_001400;LS-82938;4-22-00-05694 (Beilstein Handbook Reference) |
| CAS: | 67292-68-6 |
| Molecular Formula: | C14H20N2O |
| Molecular Weight: | 232.3214 |
| InChI: | InChI=1/C14H20N2O/c1-10-12(7-8-16(2)3)13-9-11(17-4)5-6-14(13)15-10/h5-6,9,15H,7-8H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.079g/cm3 |
| Refractive index: | 1.589 |
| Specification: |
Methyl-2-methoxy-5-N-dimethyltryptamine ,its cas register number is 67292-68-6. It also can be called 5-MeO-TMT ; and Indole, 3-(2-(dimethylamino)ethyl)-5-methoxy-2-methyl- . Methyl-2-methoxy-5-N-dimethyltryptamine (CAS NO.67292-68-6) was first synthesized by Alexander Shulgin and reported in his book TiHKAL and is claimed to show psychoactive effects at a dosage of 75-150 mg orally, but these are relatively mild compared to those of other similar compounds. |
| Safety Data | |
 |
|
