| Identification | |
| Name: | Methoxyazoxymethanolacetate |
| Synonyms: | Methanol, methoxy-ONN-azoxy-, acetate (ester) |
| CAS: | 67293-86-1 |
| Molecular Formula: | C4H8N2O4 |
| Molecular Weight: | 148.1173 |
| InChI: | InChI=1/C4H8N2O4/c1-4(7)10-3-5-6(8)9-2/h3H2,1-2H3/b6-5+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 63.5°C |
| Boiling Point: | 181.4°C at 760 mmHg |
| Density: | 1.25g/cm3 |
| Refractive index: | 1.455 |
| Specification: |
Methoxyazoxymethanolacetate , its cas register number is 67293-86-1. It also can be called Methanol, methoxy-ONN-azoxy-, acetate (ester) . Its classification code are Mutation data and Tumor data. |
| Flash Point: | 63.5°C |
| Safety Data | |
 |
|
