| Identification | |
| Name: | Neothramycin |
| Synonyms: | neothramycins |
| CAS: | 67298-49-1 |
| Molecular Formula: | C13H14N2O4 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C13H14N2O4/c1-19-11-4-8-9(5-10(11)16)14-6-7-2-3-12(17)15(7)13(8)18/h4-7,12,16-17H,2-3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 305.9°C |
| Boiling Point: | 582.3°C at 760 mmHg |
| Density: | 1.54g/cm3 |
| Refractive index: | 1.701 |
| Specification: |
Neothramycin with CAS number of 67298-49-1 is also known as 1,2,3,11A-Tetrahydro-3,8-dihydroxy-7-methoxy-5H-pyrrolo(2,1-c)(1,4)benzodiazepin-5-one ; NSC 285223 ; Neothramycin . |
| Flash Point: | 305.9°C |
| Safety Data | |
 |
|
