| Identification | |
| Name: | 2H-Pyran-2-one,tetrahydro-4-hydroxy-4-methyl- |
| CAS: | 674-26-0 |
| EINECS: | 211-615-0 |
| Molecular Formula: | C6H10 O3 |
| Molecular Weight: | 130.1418 |
| InChI: | InChI=1S/C6H10O3/c1-6(8)2-3-9-5(7)4-6/h8H,2-4H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.189 g/cm3 |
| Stability: | Hygroscopic |
| Refractive index: | n20/D 1.473(lit.) |
| Water Solubility: | Soluble in ethanol (100 mg/ml-clear to very slightly hazy faint yellow solution), dichloromethane, ethyl acetate, and methanol |
| Solubility: | Soluble in ethanol (100 mg/ml-clear to very slightly hazy faint yellow solution), dichloromethane, ethyl acetate, and methanol |
| Appearance: | Moist pale yellow to off white solid |
| Specification: |
DL-Mevalonolactone , its CAS NO. is 674-26-0, the synonyms are DL-Mevalonic acid lactone ; (4R)-4-Hydroxy-4-methyl-oxan-2-one ; (+/-)-Tetrahydro-4-hydroxy-4-methyl-2H-pyran-2-one . |
| Storage Temperature: | 2-8°C |
| Usage: | A metabolite from endophytes of the medicinal plant Erythrina crista-galli. |
| Safety Data | |
 |
|
