Identification |
Name: | Piperazine,1-[2-(diphenylmethoxy)ethyl]-4-(3-phenyl-2-propen-1-yl)- |
Synonyms: | Piperazine,1-[2-(diphenylmethoxy)ethyl]-4-(3-phenyl-2-propenyl)- (9CI); GBR 12783 |
CAS: | 67469-57-2 |
Molecular Formula: | C28H32 N2 O |
Molecular Weight: | 412.5665 |
InChI: | InChI=1/C28H32N2O/c1-4-11-25(12-5-1)13-10-18-29-19-21-30(22-20-29)23-24-31-28(26-14-6-2-7-15-26)27-16-8-3-9-17-27/h1-17,28H,18-24H2 |
Molecular Structure: |
|
Properties |
Density: | 1.085 g/cm3 |
Refractive index: | 1.601 |
Biological Activity: | A very potent and selective inhibitor of dopamine uptake (IC 50 for inhibition of [ 3 H]-dopamine uptake in rat striatal synaptosomes is 1.8 nM). |
Safety Data |
|
|