| Identification | |
| Name: | 26355-78-2 |
| Synonyms: | acrylic acid; butyl prop-2-enoate; ethylene;AC1Q66TY;AC1L521L;Ethylene, polymer with butyl acrylate and acrylic acid;AR-1H6547;butyl prop-2-enoate; ethene; prop-2-enoic acid;2-Propenoic acid, polymer with butyl 2-propenoate and ethene;26355-78-2 |
| CAS: | 67577-92-8 |
| Molecular Formula: | C12H20O4 |
| Molecular Weight: | 228.2848 |
| InChI: | InChI=1S/C7H12O2.C3H4O2.C2H4/c1-3-5-6-9-7(8)4-2;1-2-3(4)5;1-2/h4H,2-3,5-6H2,1H3;2H,1H2,(H,4,5);1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 39.4°C |
| Boiling Point: | 145.9°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 39.4°C |
| Safety Data | |
 |
|
