| Identification |
| Name: | (+/-)-1-AMINOCYCLOPENTANE-TRANS-1,3-DICARBOXYLIC ACID |
| CAS: | 67684-64-4 |
| Molecular Formula: | C7H11NO4 |
| Molecular Weight: | 173.17 |
| InChI: | InChI=1S/C7H11NO4/c8-7(6(11)12)2-1-4(3-7)5(9)10/h4H,1-3,8H2,(H,9,10)(H,11,12)/t4-,7-/m1/s1 |
| Molecular Structure: |
 |
| Properties |
| Biological Activity: | Equimolecular mixture of (1S,3R)- and (1R,3S)-ACPD. Selective agonist for metabotropic glutamate receptors; active at both group I and group II mGlu receptors (EC 50 values are 2, 15, 23 and ~800 μ M at mGluR 2 , mGluR 1 , mGluR 5 and mGluR 4 respectively). |
| Safety Data |
| |
 |
