Identification |
Name: | Prochloraz |
Synonyms: | N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]imidazole-1-carboxamide; N-propyl-N-[2-(2,4,6-trichlorophenoxy) ethyl]-1H-imidazole-1-carboxamide; N-Propyl-N-(2,4,6-trichlorophenoxy)ethyl-imidazole-1-carboxamide |
CAS: | 67747-09-5 |
EINECS: | 266-994-5 |
Molecular Formula: | C15H16Cl3N3O2 |
Molecular Weight: | 376.67 |
InChI: | InChI=1/C15H16Cl3N3O2/c1-2-4-20(15(22)21-5-3-19-10-21)6-7-23-14-12(17)8-11(16)9-13(14)18/h3,5,8-10H,2,4,6-7H2,1H3 |
Molecular Structure: |
![(C15H16Cl3N3O2) N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]imidazole-1-carboxamide; N-propyl-N-[2-(2,4,6-trichlorop...](https://img.guidechem.com/casimg/67747-09-5.gif) |
Properties |
Transport: | UN 3077 |
Density: | 1.37 g/cm3 |
Stability: | Stable at normal temperatures and pressures. |
Refractive index: | 1.596 |
Solubility: | Insoluble |
Appearance: | colorless solid |
Packinggroup: | III |
Usage: | Used to kill fungus. |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
 |