| Identification | |
| Name: | Fatty acids, C6-12, Meesters |
| Synonyms: | C6-12 fattyacids, Me esters; Off-Shoot O |
| CAS: | 67762-39-4 |
| EINECS: | 267-017-5 |
| Molecular Formula: | C9H18O2 |
| Molecular Weight: | 158.238 |
| InChI: | InChI=1/C9H18O2/c1-3-4-5-6-7-8-9(10)11-2/h3-8H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -40 deg C |
| Flash Point: | 72.8°C |
| Boiling Point: | 191.1°Cat760mmHg |
| Density: | 0.876g/cm3 |
| Refractive index: | 1.418 |
| Solubility: | Insoluble in water; very soluble in alcohol, ether In water, 64.4 mg/l @ 20 deg C |
| Specification: |
Methyl octanoate and methyl decanoate (CAS NO.67762-39-4) is also called as (C6-C12) Alkylcarboxylic acid methyl ester ; C6-12-Fatty acids methyl esters ; Caswell No. 568C ; EINECS 267-017-5 ; EPA Pesticide Chemical Code 079034 ; Fatty acids, methyl esters ; Off-Shoot O ; Fatty acids, C6-12, Me esters ; Octanoic acid, methyl ester mixed with methyl decanoate ; Methyl esters of fatty acids (C8-C12) . |
| Flash Point: | 72.8°C |
| Color: | COLORLESS, OILY LIQUID |
| Safety Data | |
 |
|
