| Identification |
| Name: | 2,5-Furandione, dihydro-, monopolyisobutenyl derivs., reaction products with triethanolamine |
| Synonyms: | 2,5-Furandione, dihydro-, monopolyisobutenyl derivs., reaction products with triethanolamine;TEA-DIETHANOLAMINOETHYL POLYISOBUTENYLSUCCINATE |
| CAS: | 67762-80-5 |
| EINECS: | 267-034-8 |
| Molecular Formula: | C10H19NO6 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C6H15NO3.C4H4O3/c8-4-1-7(2-5-9)3-6-10;5-3-1-2-4(6)7-3/h8-10H,1-6H2;1-2H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 185°C |
| Boiling Point: | 335.4°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 185°C |
| Safety Data |
| |
 |
