Identification |
Name: | 2,5-Furandione, dihydro-, monopolyisobutenyl derivs., reaction products with triethanolamine |
Synonyms: | 2,5-Furandione, dihydro-, monopolyisobutenyl derivs., reaction products with triethanolamine;TEA-DIETHANOLAMINOETHYL POLYISOBUTENYLSUCCINATE |
CAS: | 67762-80-5 |
EINECS: | 267-034-8 |
Molecular Formula: | C10H19NO6 |
Molecular Weight: | 0 |
InChI: | InChI=1/C6H15NO3.C4H4O3/c8-4-1-7(2-5-9)3-6-10;5-3-1-2-4(6)7-3/h8-10H,1-6H2;1-2H2 |
Molecular Structure: |
 |
Properties |
Flash Point: | 185°C |
Boiling Point: | 335.4°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 185°C |
Safety Data |
|
 |