| Identification | |
| Name: | 1-Benzyl hydantoin |
| Synonyms: | Hydantoin,1-benzyl- (7CI,8CI);1-Benzylhydantoin;1-Benzylimidazolidine-2,4-dione; |
| CAS: | 6777-05-5 |
| EINECS: | 421-340-1 |
| Molecular Formula: | C10H10N2O2 |
| Molecular Weight: | 190.2 |
| InChI: | InChI=1/C10H10N2O2/c13-9-7-12(10(14)11-9)6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,11,13,14) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.292 g/cm3 |
| Refractive index: | 1.597 |
| Specification: |
1-Benzyl hydantoin , with CAS number of 6777-05-5, can be called N-benzylhydantoin ; n-benzyl-2,4-imidazolinedione ; benzylhydantoin ; 1-benzyl-imidazolidine-2,4-dione ; 1-benzylhydantoin ; 1-benzyl hydantion ; n-benzylhydantion ; 1-Benzylhydantoine ; 1-Benzyl hydantoin(BHD) . |
| Safety Data | |
 |
|
