Identification |
Name: | Guanidine, cyano-, polymer with formaldehyde, ammonium salt |
Synonyms: | Guanidine, cyano-, polymer with formaldehyde, ammonium salt |
CAS: | 67786-29-2 |
Molecular Formula: | C3H8N5O |
Molecular Weight: | 0 |
InChI: | InChI=1/C2H4N4.CH3NO/c3-1-6-2(4)5;2-1-3/h(H4,4,5,6);1H,(H2,2,3)/p+1 |
Molecular Structure: |
 |
Properties |
Flash Point: | 92.8°C |
Boiling Point: | 229.8°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 92.8°C |
Safety Data |
|
 |