| Identification |
| Name: | propionic acid, compound with N-[3-(dimethylamino)propyl]dodecanamide (1:1) |
| Synonyms: | Propanoic acid, compd. with N-(3-(dimethylamino)propyl)dodecanamide (1:1);N,N-Dimethyl-N-(3-dodecanamidopropyl)amine, propionic acid salt;N,N-Dimethyl-N-(3-laurylamidopropyl)amine monopropionic acid salt;Propionic acid, compound with N-(3-(dimethylamino)propyl)dodecanamide (1:1);propanoic acid - N-[3-(dimethylamino)propyl]dodecanamide (1:1) |
| CAS: | 67801-62-1 |
| EINECS: | 267-182-3 |
| Molecular Formula: | C20H42N2O3 |
| Molecular Weight: | 358.5591 |
| InChI: | InChI=1/C17H36N2O.C3H6O2/c1-4-5-6-7-8-9-10-11-12-14-17(20)18-15-13-16-19(2)3;1-2-3(4)5/h4-16H2,1-3H3,(H,18,20);2H2,1H3,(H,4,5) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 207.1°C |
| Boiling Point: | 418.9°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 207.1°C |
| Safety Data |
| |
 |
