| Identification | |
| Name: | 2-Thiophenecarboxylicacid, 5-formyl-, methyl ester |
| Synonyms: | 5-Formylthiophene-2-carboxylicacid methyl ester;Methyl 5-formyl-2-thiophenecarboxylate; |
| CAS: | 67808-64-4 |
| Molecular Formula: | C7H6O3S |
| Molecular Weight: | 170.19 |
| InChI: | InChI=1/C7H6O3S/c1-10-7(9)6-3-2-5(4-8)11-6/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.324 g/cm3 |
| Refractive index: | 1.586 |
| Specification: |
The systematic name of Methyl 5-formyl-2-thiophenecarboxylate is Methyl 5-formylthiophene-2-carboxylate. With the CAS registry number 67808-64-4, it is also named as 5-Formylthiophene-2-carboxylic acid methyl ester. The product's category is Pharmaceutical Intermediates. In addition, its molecular formula is C7H6O3S and its molecular weight is 170.19. The other characteristics of Methyl 5-formyl-2-thiophenecarboxylate can be summarized as: (1)ACD/LogP: 1.20; (2)# of Rule of 5 Violations: 0; (3)H bond acceptors: 3; (4)H bond donors: 0; (5)Nominal mass: 170; (6)Average mass: 170.1857; (7)Monoisotopic mass: 170.003764; (8)Freely Rotating Bonds: 3; (9)Polar Surface Area: 71.61 Å2; (10)Index of Refraction: 1.586; (11)Molar Refractivity: 43.16 cm3; (12)Molar Volume: 128.4 cm3; (13)Polarizability: 17.11×10-24cm3; (14)Surface Tension: 49.2 dyne/cm; (15)Density: 1.324 g/cm3; (16)Flash Point: 137.9 °C; (17)Enthalpy of Vaporization: 54.47 kJ/mol; (18)Boiling Point: 304.3 °C at 760 mmHg; (19)Vapour Pressure: 0.00088 mmHg at 25 °C. People can use the following data to convert to the molecule structure. |
| Safety Data | |
 |
|
