| Identification | |
| Name: | Benzenamine,2-methoxy-5-nitro-, hydrochloride (1:1) |
| Synonyms: | Benzenamine,2-methoxy-5-nitro-, monohydrochloride (9CI);o-Anisidine, 5-nitro-,hydrochloride (5CI);2-Methoxy-5-nitroaniline hydrochloride; |
| CAS: | 67827-72-9 |
| EINECS: | 267-234-5 |
| Molecular Formula: | C7H8N2O3.HCl |
| Molecular Weight: | 204.61 |
| InChI: | InChI=1/C7H8N2O3.ClH/c1-12-7-3-2-5(9(10)11)4-6(7)8;/h2-4H,8H2,1H3;1H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 118 deg C |
| Solubility: | Very sol in alcohol, acetone, benzene, acetic acid, ethyl acetate; soluble in ligroine SLIGHTLY SOL IN PETROLEUM ETHER In water, 115 mg/l @ 23 deg C |
| Specification: |
The 2-Methoxy-5-nitroaniline hydrochloride, with the cas registry number 67827-72-9 and EINECS registry number 267-234-5, is also called 2-Methoxy-5-nitroanilinium chloride. And the molecular formula of the chemical is C7H8N2O3.HCl. The characteristics of this chemical are as followings: (1)ACD/LogP: 1.69; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.69; (4)ACD/LogD (pH 7.4): 1.69; (5)ACD/BCF (pH 5.5): 11.37; (6)ACD/BCF (pH 7.4): 11.38; (7)ACD/KOC (pH 5.5): 198.3; (8)ACD/KOC (pH 7.4): 198.47; (9)#H bond acceptors: 5; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 3; (12)Polar Surface Area: 58.29 Å2; (13)Flash Point: 166.6 °C; (14)Enthalpy of Vaporization: 59.65 kJ/mol; (15)Boiling Point: 351.8 °C at 760 mmHg; (16)Vapour Pressure: 4.01E-05 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Color: | ORANGE-RED NEEDLES FROM ALC, ETHER, WATER Red needles from alcohol |
| Safety Data | |
 |
|
