| Identification | |
| Name: | (2Z)-4-(octyloxy)-4-oxobut-2-enoic acid - ethenyl acetate (1:1) |
| Synonyms: | AC1O5BQY;Acetic acid ethenyl ester, polymer with octyl hydrogen (2Z)-2-butenedioate;Vinyl acetate, monooctyl maleate polymer;ethenyl acetate; (Z)-4-octoxy-4-oxobut-2-enoic acid;Acetic acid ethenyl ester, polymer with 1-octyl hydrogen (2Z)-2-butenedioate;67828-13-1 |
| CAS: | 67828-13-1 |
| Molecular Formula: | C16H26O6 |
| Molecular Weight: | 314.374 |
| InChI: | InChI=1/C12H20O4.C4H6O2/c1-2-3-4-5-6-7-10-16-12(15)9-8-11(13)14;1-3-6-4(2)5/h8-9H,2-7,10H2,1H3,(H,13,14);3H,1H2,2H3/b9-8-; |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 125.7°C |
| Boiling Point: | 348°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 125.7°C |
| Safety Data | |
 |
|
