| Identification |
| Name: | ethyl dihydrogen phosphate, compound with N,N-dimethyldodecylamine (1:1) |
| Synonyms: | Phosphoric acid, monoethyl ester, compd. with N,N-dimethyl-1-dodecanamine (1:1);Ethyl dihydrogen phosphate, compound with N,N-dimethyldodecylamine(1:1);ethyl dihydrogen phosphate - N,N-dimethyldodecan-1-amine (1:1) |
| CAS: | 67846-09-7 |
| EINECS: | 267-355-3 |
| Molecular Formula: | C16H38NO4P |
| Molecular Weight: | 339.451 |
| InChI: | InChI=1/C14H31N.C2H7O4P/c1-4-5-6-7-8-9-10-11-12-13-14-15(2)3;1-2-6-7(3,4)5/h4-14H2,1-3H3;2H2,1H3,(H2,3,4,5) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 106.9°C |
| Boiling Point: | 265.2°C at 760 mmHg |
| Flash Point: | 106.9°C |
| Safety Data |
| |
 |
