| Identification |
| Name: | octyl dihydrogen phosphate, compound with N,N-dimethyloctadecylamine (1:1) |
| Synonyms: | Phosphoric acid, monooctyl ester, compd. with N,N-dimethyl-1-octadecanamine (1:1);Octyl dihydrogen phosphate, compound with N,N-dimethyloctadecylamine (1:1);octyl dihydrogen phosphate - N,N-dimethyloctadecan-1-amine (1:1) |
| CAS: | 67846-18-8 |
| EINECS: | 267-362-1 |
| Molecular Formula: | C28H62NO4P |
| Molecular Weight: | 507.7699 |
| InChI: | InChI=1/C20H43N.C8H19O4P/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(2)3;1-2-3-4-5-6-7-8-12-13(9,10)11/h4-20H2,1-3H3;2-8H2,1H3,(H2,9,10,11) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 153.8°C |
| Boiling Point: | 348.5°C at 760 mmHg |
| Flash Point: | 153.8°C |
| Safety Data |
| |
 |
