| Identification |
| Name: | Isophthalic acid, oligomeric reaction products with 1-chloro-2,3-epoxypropane and phthalic anhydride |
| Synonyms: | 1,3-Benzenedicarboxylic acid, polymer with 2-(chloromethyl)oxirane and 1,3-isobenzofurandione;(Chloromethyl)oxirane, phthalic anhydride, isophthalic acid polymer;1,3-Benzenedicarboxylic acid, polymer with (chloromethyl)oxirane and 1,3-isobenzofurandione;2-(chloromethyl)oxirane; isobenzofuran-1,3-dione; isophthalic acid |
| CAS: | 67846-32-6 |
| EINECS: | 500-174-2 |
| Molecular Formula: | C19H15ClO8 |
| Molecular Weight: | 406.7706 |
| InChI: | InChI=1/C8H6O4.C8H4O3.C3H5ClO/c9-7(10)5-2-1-3-6(4-5)8(11)12;9-7-5-3-1-2-4-6(5)8(10)11-7;4-1-3-2-5-3/h1-4H,(H,9,10)(H,11,12);1-4H;3H,1-2H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 217.3°C |
| Boiling Point: | 412.3°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 217.3°C |
| Safety Data |
| |
 |
