Identification |
Name: | 2-Propenoic acid, ethyl ester, polymer with N-(hydroxymethyl)-2-propenamide and methyl 2-propenoate |
Synonyms: | AC1O5BSA;Methyl acrylate, N-methylolacrylamide, ethyl acrylate polymer;Methyl acrylate, N-methylol acrylamide, ethyl acrylate polymer;ethyl prop-2-enoate; N-(hydroxymethyl)prop-2-enamide; methyl prop-2-enoate;2-Propenoic acid, ethyl ester, polymer with N-(hydroxymethyl)-2-propenamide and methyl 2-propenoate;67846-39-3 |
CAS: | 67846-39-3 |
Molecular Formula: | C13H21NO6 |
Molecular Weight: | 287.30894 |
InChI: | InChI=1S/C5H8O2.C4H7NO2.C4H6O2/c1-3-5(6)7-4-2;1-2-4(7)5-3-6;1-3-4(5)6-2/h3H,1,4H2,2H3;2,6H,1,3H2,(H,5,7);3H,1H2,2H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 15.6°C |
Boiling Point: | 99.5°Cat760mmHg |
Density: | g/cm3 |
Flash Point: | 15.6°C |
Safety Data |
|
 |