Identification |
Name: | dodecyl 2-methylprop-2-enoate - 1-ethenyl-2-methylbenzene (1:1) |
Synonyms: | AC1O5BSP;Vinyl toluene, polymer with lauryl methacrylate;dodecyl 2-methylprop-2-enoate; 1-ethenyl-2-methylbenzene;2-Propenoic acid, 2-methyl-, dodecyl ester, polymer with ethenylmethylbenzene;67859-82-9 |
CAS: | 67859-82-9 |
Molecular Formula: | C25H40O2 |
Molecular Weight: | 372.5839 |
InChI: | InChI=1/C16H30O2.C9H10/c1-4-5-6-7-8-9-10-11-12-13-14-18-16(17)15(2)3;1-3-9-7-5-4-6-8(9)2/h2,4-14H2,1,3H3;3-7H,1H2,2H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 133.8°C |
Boiling Point: | 322.7°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 133.8°C |
Safety Data |
|
 |