The N-Isopropylglycinamide, with the CAS registry number 67863-05-2, is also known as 2-Amino-N-isopropylacetamide. This chemical's molecular formula is C5H12N2O and molecular weight is 116.16. Its IUPAC name is called [2-oxo-2-(propan-2-ylamino)ethyl]azanium.
Physical properties of N-Isopropylglycinamide: (1)ACD/LogP: -0.91; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -2.62; (4)ACD/LogD (pH 7.4): -1.13; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 4.6; (9)#H bond acceptors: 3; (10)#H bond donors: 3; (11)#Freely Rotating Bonds: 3; (12)Index of Refraction: 1.446; (13)Molar Refractivity: 32.33 cm3; (14)Molar Volume: 121 cm3; (15)Surface Tension: 33.1 dyne/cm; (16)Density: 0.959 g/cm3; (17)Flash Point: 111.2 °C; (18)Enthalpy of Vaporization: 49.79 kJ/mol; (19)Boiling Point: 260.2 °C at 760 mmHg; (20)Vapour Pressure: 0.0124 mmHg at 25°C.
You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CC(C)NC(=O)C[NH3+]
(2)InChI: InChI=1S/C5H12N2O/c1-4(2)7-5(8)3-6/h4H,3,6H2,1-2H3,(H,7,8)/p+1
(3)InChIKey: LKCKUYRPMPUHTD-UHFFFAOYSA-O
|