Identification |
Name: | Hexanedioic acid, dimethyl ester, polymer with 1,4-cyclohexanedimethanol and dimethyl pentanedioate |
Synonyms: | Hexanedioic acid, dimethyl ester, polymer with 1,4-cyclohexanedimethanol and dimethyl pentanedioate |
CAS: | 67892-58-4 |
Molecular Formula: | C23H42O10 |
Molecular Weight: | 0 |
InChI: | InChI=1/C8H14O4.C8H16O2.C7H12O4/c1-11-7(9)5-3-4-6-8(10)12-2;9-5-7-1-2-8(6-10)4-3-7;1-10-6(8)4-3-5-7(9)11-2/h3-6H2,1-2H3;7-10H,1-6H2;3-5H2,1-2H3 |
Molecular Structure: |
|
Properties |
Flash Point: | 107.2°C |
Boiling Point: | 228.7°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 107.2°C |
Safety Data |
|
|