| Identification | |
| Name: | Naphtho[2,1-b]furan,dodecahydro-3a,6,6,9a-tetramethyl-, (3aR,5aS,9aS,9bR)- |
| Synonyms: | Naphtho[2,1-b]furan,dodecahydro-3a,6,6,9a-tetramethyl-, [3aR-(3aa,5ab,9aa,9bb)]-;(-)-Ambrox;(-)-Ambroxan;(-)-Ambroxide;(-)-Norlabdane oxide;Amberlyn Super;Amberlyn Super PM 577;Ambroxide; |
| CAS: | 6790-58-5 |
| EINECS: | 229-861-2 |
| Molecular Formula: | C16H28O |
| Molecular Weight: | 236.39 |
| InChI: | InChI=1/C16H28O/c1-14(2)8-5-9-15(3)12(14)6-10-16(4)13(15)7-11-17-16/h12-13H,5-11H2,1-4H3 |
| Molecular Structure: | ![(C16H28O) Naphtho[2,1-b]furan,dodecahydro-3a,6,6,9a-tetramethyl-, [3aR-(3aa,5ab,9aa,9bb)]-;(-)-Ambrox;(-)-Ambr...](https://img.guidechem.com/casimg/6790-58-5.gif) |
| Properties | |
| Flash Point: | 104.8ºC |
| Boiling Point: | 273.9 ºC at 760 mmHg |
| Density: | 0.939 |
| Refractive index: | 1.48 |
| Alpha: | -30 º (C=1% IN TOLUENE) |
| Appearance: | white crystals |
| Specification: |
Ambroxide with cas registry number of 6790-58-5 is colorless to white crystalline solid, known as 8alpha,12-Oxido-13,14,15,16-tetranorlabdane ; Dodecahydro-3a,6,6,9a-tetramethylnaphtho(2,1-b)furan, (3aR-(3aalpha,5abeta,9aalpha,9bbeta))- ; FEMA No. 3471 ; Naphtho(2,1-b)furan, dodecahydro-3a,6,6,9a-tetramethyl-, (3aR-(3aalpha,5abeta,9aalpha,9bbeta))- ; (3AR-(3aalpha,5abeta,9aalpha,9bbeta))-dodecahydro-3a,6,6,9a-tetramethylnaphtho(2,1-b)furan ; Naphtho(2,1-b)furan, dodecahydro-3a,6,6,9a-tetramethyl-, (3aR,5aS,9aS,9bR)- ; 1,5,5,9-Tetramethyl-13-oxatricyclo(8.3.0.0(sup 4,9))tridecane . It is used in flavor of advanced perfumes and cosmetics. |
| Flash Point: | 104.8ºC |
| Safety Data | |
 |
|
