| Identification |
| Name: | oleic acid, compound with 1,1',1''-nitrilotri(propan-2-ol) (1:1) |
| Synonyms: | 9-Octadecenoic acid (9Z)-, compd. with 1,1',1''-nitrilotris(2-propanol) (1:1);Oleic acid, triisopropanolamine salt;9-Octadecenoic acid (Z)-, compd. with 1,1',1''-nitrilotris(2-propanol) (1:1);Oleic acid, compound with 1,1',1''-nitrilotri(propan-2-ol) (1:1);(9Z)-octadec-9-enoic acid - 1,1',1''-nitrilotripropan-2-ol (1:1) |
| CAS: | 67952-35-6 |
| EINECS: | 267-888-1 |
| Molecular Formula: | C27H55NO5 |
| Molecular Weight: | 473.7293 |
| InChI: | InChI=1/C18H34O2.C9H21NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-7(11)4-10(5-8(2)12)6-9(3)13/h9-10H,2-8,11-17H2,1H3,(H,19,20);7-9,11-13H,4-6H2,1-3H3/b10-9-; |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 270.1°C |
| Boiling Point: | 360°C at 760 mmHg |
| Flash Point: | 270.1°C |
| Safety Data |
| |
 |
