| Identification | |
| Name: | Mercaptoacetic acid |
| Synonyms: | Thioglycolic acid solution; thioglycolic acid free acid; Thioglycollic acid; Thioglycolic acid; Thioglypollic Acid |
| CAS: | 68-11-1 |
| EINECS: | 200-677-4 |
| Molecular Formula: | C2H4O2S |
| Molecular Weight: | 92.11 |
| InChI: | InChI=1/C2H4O2S/c3-2(4)1-5/h5H,1H2,(H,3,4) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1940/2436 |
| Density: | 1.325 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. Oxidizes when exposed to air. |
| Refractive index: | 1.503-1.505 |
| Water Solubility: | soluble |
| Solubility: | Miscible |
| Appearance: | Clear liquid |
| Packinggroup: | II |
| HS Code: | 29309070 |
| Sensitive: | Air Sensitive |
| Color: | Clear, colorless liquid Water-white liquid |
| Usage: | Chemical intermediate for thioglycolates (eg, calcium thioglycolate), ingredient of depilatories, permanent hair wave solutions and biological media for microorganism growth, reagent for detection of iron and other metal ions, chelating agent. |
| Safety Data | |
| Hazard Symbols |
T+:Verytoxic
|
 |
|
