| Identification | |
| Name: | 9H-Pyrido[2,3-b]indol-2-amine,3-methyl- |
| Synonyms: | 1H-Pyrido[2,3-b]indol-2-amine,3-methyl- (9CI); 2-Amino-3-methyl-9H-pyrido[2,3-b]indole; 2-Amino-3-methyl-a-carboline; 3-Methyl-9H-1,9-diazafluoren-2-amine |
| CAS: | 68006-83-7 |
| Molecular Formula: | C12H11 N3 |
| Molecular Weight: | 197.2 |
| InChI: | InChI=1/C12H11N3/c1-7-6-9-8-4-2-3-5-10(8)14-12(9)15-11(7)13/h2-6H,1H3,(H3,13,14,15) |
| Molecular Structure: | ![(C12H11N3) 1H-Pyrido[2,3-b]indol-2-amine,3-methyl- (9CI); 2-Amino-3-methyl-9H-pyrido[2,3-b]indole; 2-Amino-3-me...](https://img1.guidechem.com/chem/e/dict/28/68006-83-7.jpg) |
| Properties | |
| Transport: | 2811 |
| Melting Point: | 215-218 |
| Flash Point: | 252.1°C |
| Boiling Point: | 443.2°Cat760mmHg |
| Density: | 1.334g/cm3 |
| Refractive index: | 1.806 |
| Specification: |
2-Amino-3-methyl-9H-pyrido(2,3-b)indole ,its CAS NO. is 68006-83-7,the synonyms is 2-Amino-3-methyl-1h-pyrido(2,3-b)indole ; 2-Amino-3-methyl-alpha-carboline ; (3-b)Indole,2-amino-3-methyl-9h-pyrido ; 3-Methyl-1h-pyrido(2,3-b)indol-2-amine;meac ; 2-Amino-3-methyl-9h-pyrido[2,3-b]indole ; 2-Amino-3-methyl-pyrido(2,3-b)indole ; 2-Amino-3-methyl-9h-pyridol(2,3-b)indole . |
| Packinggroup: | III |
| Flash Point: | 252.1°C |
| Usage: |
A pyrolysate of protein that exhibits potent mutagenic principles toward Salmonella typhimurium TA98 and TA100. |
| Safety Data | |
 |
|
