Identification |
Name: | Siloxanes andSilicones, di-Ph, polymers with Me Ph silsesquioxanes |
Synonyms: | Silsesquioxanes,Me Ph, polymers with di-Ph siloxanes |
CAS: | 68037-75-2 |
Molecular Formula: | C17H20OSi |
Molecular Weight: | 0 |
InChI: | InChI=1/C17H20OSi/c1-3-9-15(10-4-1)17(16-11-5-2-6-12-16)19-14-8-7-13-18-19/h1-6,9-12,17,19H,7-8,13-14H2 |
Molecular Structure: |
 |
Properties |
Flash Point: | 168.42°C |
Boiling Point: | 354.871°C at 760 mmHg |
Flash Point: | 168.42°C |
Safety Data |
|
 |