| Identification | |
| Name: | Amines,C14-18-alkyldimethyl |
| Synonyms: | Farmin DM8680 |
| CAS: | 68037-93-4 |
| EINECS: | 268-217-5 R(CH3)2N |
| Molecular Formula: | C18H39N |
| Molecular Weight: | 269.50896 |
| InChI: | InChI=1S/C18H39N/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(2)3/h4-18H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 160kgs |
| Flash Point: | 140.4°C |
| Boiling Point: | 323.6°Cat760mmHg |
| Density: | 0.809g/cm3 |
| Water Solubility: | Insoluble (soluble in alcohol, ether) |
| Solubility: | Insoluble (soluble in alcohol, ether)
Appearance:clear to yellowish
liquid Transport Information:160kgs Hazard Symbols:8 (Packing group: II) UN NO. |
| Appearance: | clear to yellowish liquid |
| Flash Point: | 140.4°C |
| Safety Data | |
| Hazard Symbols |
8 (Packing group: II)
UN
NO.
|
 |
|
