| Identification |
| Name: | benzoic acid, compound with 2-(diethylamino)ethanol (1:1) |
| Synonyms: | Ethanol, 2-(diethylamino)-, benzoate (1:1);Diethylethanolamine benzoate;Benzoic acid, compound with 2-(diethylamino)ethanol (1:1);Ethanol, 2-(diethylamino)-, benzoate (salt);2-(diethylamino)ethanol benzoate (1:1) |
| CAS: | 68052-36-8 |
| EINECS: | 268-318-4 |
| Molecular Formula: | C13H21NO3 |
| Molecular Weight: | 239.3107 |
| InChI: | InChI=1/C7H6O2.C6H15NO/c8-7(9)6-4-2-1-3-5-6;1-3-7(4-2)5-6-8/h1-5H,(H,8,9);8H,3-6H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 111.4°C |
| Boiling Point: | 249.3°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 111.4°C |
| Safety Data |
| |
 |
