Identification |
Name: | benzoic acid, compound with 2-(diethylamino)ethanol (1:1) |
Synonyms: | Ethanol, 2-(diethylamino)-, benzoate (1:1);Diethylethanolamine benzoate;Benzoic acid, compound with 2-(diethylamino)ethanol (1:1);Ethanol, 2-(diethylamino)-, benzoate (salt);2-(diethylamino)ethanol benzoate (1:1) |
CAS: | 68052-36-8 |
EINECS: | 268-318-4 |
Molecular Formula: | C13H21NO3 |
Molecular Weight: | 239.3107 |
InChI: | InChI=1/C7H6O2.C6H15NO/c8-7(9)6-4-2-1-3-5-6;1-3-7(4-2)5-6-8/h1-5H,(H,8,9);8H,3-6H2,1-2H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 111.4°C |
Boiling Point: | 249.3°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 111.4°C |
Safety Data |
|
 |