Specification: |
The 3H-Imidazo[4,5-c]pyridin-2-amine, with the CAS registry number 68074-63-5, has the molecular formula C6H6N4. In addition, its molecular weight is 134.14. Its IUPAC name is called 3H-imidazo[4,5-c]pyridin-2-amine.
Physical properties of 3H-Imidazo[4,5-c]pyridin-2-amine: (1)ACD/LogP: 0.43; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 1; (5)ACD/KOC (pH 7.4): 1; (6)#H bond acceptors: 4; (7)#H bond donors: 3; (8)Index of Refraction: 1.806; (9)Molar Refractivity: 38.947 cm3; (10)Molar Volume: 90.599 cm3; (11)Surface Tension: 97.702 dyne/cm; (12)Density: 1.481 g/cm3; (13)Flash Point: 241.036 °C; (14)Enthalpy of Vaporization: 68.058 kJ/mol; (15)Boiling Point: 425.859 °C at 760 mmHg; (16)Vapour Pressure: 0 mmHg at 25°C.
You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=CN=CC2=C1N=C(N2)N
(2)InChI: InChI=1S/C6H6N4/c7-6-9-4-1-2-8-3-5(4)10-6/h1-3H,(H3,7,9,10)
(3)InChIKey: KYAFCVSEPWYUSW-UHFFFAOYSA-N
|