Identification |
Name: | Propanol, oxybis-, polymer with 1,1-methylenebisisocyanatobenzene |
Synonyms: | Propanol, oxybis-, polymer with 1,1-methylenebisisocyanatobenzene;Dipropylene glycol, methylenebis(phenylisocyanate) polymer;Oxybispropanol polymer with 1,1'-methylenebis[isocyanatobenzene] |
CAS: | 68092-57-9 |
Molecular Formula: | C21H28N2O5 |
Molecular Weight: | 0 |
InChI: | InChI=1/C15H14N2O2.C6H14O3/c18-12-16-14(7-3-1-4-8-14)11-15(17-13-19)9-5-2-6-10-15;7-3-1-5-9-6-2-4-8/h1-7,9H,8,10-11H2;7-8H,1-6H2 |
Molecular Structure: |
![(C21H28N2O5) Propanol, oxybis-, polymer with 1,1-methylenebisisocyanatobenzene;Dipropylene glycol, methylenebis(p...](https://img.guidechem.com/crawlimg/68092-57-9.png) |
Properties |
Flash Point: | 151.3°C |
Boiling Point: | 367°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 151.3°C |
Safety Data |
|
![](/images/detail_15.png) |