| Identification | |
| Name: | Decanoic acid, ester with 2,2-bis(hydroxymethyl)-1,3-propanediol 2-ethylhexanoate octanoate |
| Synonyms: | Decanoic acid, ester with 2,2-bis(hydroxymethyl)-1,3-propanediol 2-ethylhexanoate octanoate;Einecs 268-582-0;Pentaerythritol 2-ethylhexanoate octanoate decanoate;Pentaerythritol, 2-ethylhexanoic acid,caprylic acid, capric acid mixed ester |
| CAS: | 68130-25-6 |
| EINECS: | 268-582-0 |
| Molecular Formula: | C30H62O10 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C9H18O2.2C8H16O2.C5H12O4/c1-2-3-4-5-6-7-8-9(10)11;1-3-5-6-7(4-2)8(9)10;1-2-3-4-5-6-7-8(9)10;6-1-5(2-7,3-8)4-9/h2-8H2,1H3,(H,10,11);7H,3-6H2,1-2H3,(H,9,10);2-7H2,1H3,(H,9,10);6-9H,1-4H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 114.9°C |
| Boiling Point: | 254.9°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 114.9°C |
| Safety Data | |
 |
|
