Identification |
Name: | 1,2-Benzenedicarboxylic acid, mixed cyclohexyl and 2-ethylhexyl esters |
Synonyms: | 2-Ethylhexanol, cyclohexanol, phthalic anhydride mixed esters;Phthalic acid mixed cyclohexyl and 2-ethylhexyl esters;cyclohexyl (2R)-2-ethylhexyl benzene-1,2-dicarboxylate |
CAS: | 68130-49-4 |
EINECS: | 268-592-5 |
Molecular Formula: | C22H32O4 |
Molecular Weight: | 360.4871 |
InChI: | InChI=1/C22H32O4/c1-3-5-11-17(4-2)16-25-21(23)19-14-9-10-15-20(19)22(24)26-18-12-7-6-8-13-18/h9-10,14-15,17-18H,3-8,11-13,16H2,1-2H3/t17-/m1/s1 |
Molecular Structure: |
 |
Properties |
Flash Point: | 207.8°C |
Boiling Point: | 437.1°C at 760 mmHg |
Density: | 1.06g/cm3 |
Refractive index: | 1.514 |
Flash Point: | 207.8°C |
Safety Data |
|
 |