| Identification | |
| Name: | disodium hydrogen phosphate, compound with triethylamine (1:1) |
| Synonyms: | Phosphoric acid, sodium salt, compd. with N,N-diethylethanamine (1:2:1);Phosphoric acid, triethanolamine disodium salt;Disodium hydrogen phosphate, compound with triethylamine (1:1);Phosphoric acid, disodium salt, compd. with N,N-diethylethanamine (1:1);sodium hydrogen phosphate - N,N-diethylethanamine (2:1:1) |
| CAS: | 68155-77-1 |
| EINECS: | 268-989-3 |
| Molecular Formula: | C6H16NNa2O4P |
| Molecular Weight: | 243.1488 |
| InChI: | InChI=1/C6H15N.2Na.H3O4P/c1-4-7(5-2)6-3;;;1-5(2,3)4/h4-6H2,1-3H3;;;(H3,1,2,3,4)/q;2*+1;/p-2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | 90.5°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | °C |
| Safety Data | |
 |
|
