Identification |
Name: | dimethyl hydrogen phosphorate, compound with 4-tetrapropyleneaniline |
Synonyms: | dimethyl hydrogen phosphorate, compound with 4-tetrapropyleneaniline;Phosphoric acid, dimethyl ester, compd. with 4-tetrapropylenebenzenamine (1:1);Einecs 269-016-5 |
CAS: | 68170-22-9 |
EINECS: | 269-016-5 |
Molecular Formula: | C18H31N.C2H7O4P |
Molecular Weight: | 0 |
InChI: | InChI=1/C18H31N.C2H7O4P/c1-2-3-4-5-6-7-8-9-10-11-12-17-13-15-18(19)16-14-17;1-5-7(3,4)6-2/h13-16H,2-12,19H2,1H3;1-2H3,(H,3,4) |
Molecular Structure: |
|
Properties |
Flash Point: | 162.7°C |
Boiling Point: | 364°C at 760 mmHg |
Flash Point: | 162.7°C |
Safety Data |
|
|