| Identification | |
| Name: | Benzenepropanol, g-amino-3-chloro- |
| Synonyms: | 1-Propanol,3-amino-3-(m-chlorophenyl)- (7CI);3-(3-chlorophenyl)-DL-beta-alaninol;3-amino-3-(3-chlorophenyl)-1-propanol; |
| CAS: | 68208-25-3 |
| Molecular Formula: | C9H12ClNO |
| Molecular Weight: | 185.65 |
| InChI: | InChI=1/C9H12ClNO/c10-8-3-1-2-7(6-8)9(11)4-5-12/h1-3,6,9,12H,4-5,11H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.216 g/cm3 |
| Refractive index: | 1.574 |
| Specification: |
The 3-Amino-3-(3-chlorophenyl)propan-1-ol, with the cas registry number 68208-25-3, is also called 3-(3-chlorophenyl)-DL-beta-alaninol. The molecular formula of the chemical is C9H12ClNO. The characteristics of this chemical are as followings: (1)ACD/LogP: 1.19; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -1.75; (4)ACD/LogD (pH 7.4): -0.36; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 2.97; (9)#H bond acceptors: 2; (10)#H bond donors: 3; (11)#Freely Rotating Bonds: 5; (12)Polar Surface Area: 12.47 Å2; (13)Index of Refraction: 1.574; (14)Molar Refractivity: 50.4 cm3; (15)Molar Volume: 152.6 cm3; (16)Polarizability: 19.98×10-24cm3; (17)Surface Tension: 49 dyne/cm; (18)Density: 1.216 g/cm3; (19)Flash Point: 152.1 °C; (20)Enthalpy of Vaporization: 60.2 kJ/mol; (21)Boiling Point: 327.9 °C at 760 mmHg; (22)Vapour Pressure: 7.93E-05 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
