| Identification | |
| Name: | Benzenemethanamine,2-fluoro-a-methyl-, (aS)- |
| Synonyms: | Benzenemethanamine,2-fluoro-a-methyl-, (S)-;(S)-1-(2-Fluorophenyl)ethanamine;(S)-1-(2-Fluorophenyl)ethylamine; |
| CAS: | 68285-25-6 |
| Molecular Formula: | C8H10FN |
| Molecular Weight: | 139.17 |
| InChI: | InChI=1/C8H10FN/c1-6(10)7-4-2-3-5-8(7)9/h2-6H,10H2,1H3/t6-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.063 g/cm3 |
| Refractive index: | 1.512 |
| Specification: |
The CAS register number of (S)-1-(2-Fluorophenyl)ethylamine is 68285-25-6. It also can be called as Benzenemethanamine,2-fluoro-a-methyl-, (aS)- and the IUPAC name about this chemical is (1S)-1-(2-fluorophenyl)ethanamine. Physical properties about (S)-1-(2-Fluorophenyl)ethylamine are: (1)ACD/LogP: 1.49; (2)ACD/LogD (pH 5.5): -1.54; (3)ACD/LogD (pH 7.4): -0.41; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 1.95; (8)#H bond acceptors: 1; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 2; (11)Polar Surface Area: 3.24Å2; (12)Index of Refraction: 1.512; (13)Molar Refractivity: 39.33 cm3; (14)Molar Volume: 130.8 cm3; (15)Polarizability: 15.59x10-24cm3; (16)Surface Tension: 35.1 dyne/cm; (17)Enthalpy of Vaporization: 41.6 kJ/mol; (18)Boiling Point: 179.8 °C at 760 mmHg; (19)Vapour Pressure: 0.926 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
