| Identification | |
| Name: | Propanedioic acid,2-amino-, 1,3-diethyl ester |
| Synonyms: | Malonicacid, amino-, diethyl ester (6CI,7CI,8CI);Propanedioic acid, amino-, diethylester (9CI);Aminomalonic acid diethyl ester;Diethyl 2-aminomalonate;Diethylaminomalonate;NSC 121992; |
| CAS: | 6829-40-9 |
| EINECS: | 229-905-0 |
| Molecular Formula: | C7H13NO4 |
| Molecular Weight: | 211.64336 |
| InChI: | InChI=1S/C7H13NO4.ClH/c1-3-11-6(9)5(8)7(10)12-4-2;/h5H,3-4,8H2,1-2H3;1H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.129 g/cm3 |
| Water Solubility: | Soluble in water, ethanol, ethyl ether, dissolved in acetone, benzene |
| Solubility: | Soluble in water, ethanol, ethyl ether, dissolved in acetone, benzene |
| Appearance: | a colorless liquid |
| Specification: | Colourless Oil usageEng:Reagent used in the synthesis of Imidazole derivatives. |
| Usage: | Reagent used in the synthesis of Imidazole derivatives. |
| Safety Data | |
 |
|
